C18H41N3 — CID 165377780
N-[[di(propan-2-yl)amino]methyl]-N,N',N'-tri(propan-2-yl)ethane-1,2-diamine (PubChem CID 165377780) has the molecular formula C18H41N3 and a molecular weight of 299.55 g/mol. Its IUPAC name is N-[[di(propan-2-yl)amino]methyl]-N,N',N'-tri(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[[di(propan-2-yl)amino]methyl]-N,N',N'-tri(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 165377780 |
| Molecular Formula | C18H41N3 |
| Molecular Weight | 299.55 g/mol |
| Exact Mass | 299.33 |
| IUPAC Name | N-[[di(propan-2-yl)amino]methyl]-N,N',N'-tri(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCN(C(C)C)C(C)C)CN(C(C)C)C(C)C |
| InChI | InChI=1S/C18H41N3/c1-14(2)19(13-21(17(7)8)18(9)10)11-12-20(15(3)4)16(5)6/h14-18H,11-13H2,1-10H3 |
| InChIKey | AYQDKMCAPDEZIR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|