N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen

C10H28N2 — CID 142371506

IUPACN',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen
SMILESCC.CC(C)N(CCN)C(C)C.[H][H]
InChIInChI=1S/C8H20N2.C2H6.H2/c1-7(2)10(6-5-9)8(3)4;1-2;/h7-8H,5-6,9H2,1-4H3;1-2H3;1H
InChIKeyKMOUCZSKLQDLGA-UHFFFAOYSA-N
MW176.35 g/mol
LogP2.34
Rot. Bonds4

About N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen

N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen (PubChem CID 142371506) has the molecular formula C10H28N2 and a molecular weight of 176.35 g/mol. Its IUPAC name is N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen.

Molecular Properties

Compound NameN',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen
PubChem CID142371506
Molecular FormulaC10H28N2
Molecular Weight176.35 g/mol
Exact Mass176.23
IUPAC NameN',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen
SMILESCC.CC(C)N(CCN)C(C)C.[H][H]
InChIInChI=1S/C8H20N2.C2H6.H2/c1-7(2)10(6-5-9)8(3)4;1-2;/h7-8H,5-6,9H2,1-4H3;1-2H3;1H
InChIKeyKMOUCZSKLQDLGA-UHFFFAOYSA-N
XLogP2.34
TPSA29.26 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.35
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen?
The IUPAC name of N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen (CID 142371506) is N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen.
What is the SMILES notation for N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen?
The canonical SMILES for N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen is CC.CC(C)N(CCN)C(C)C.[H][H].
What is the InChIKey of N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen?
The InChIKey is KMOUCZSKLQDLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2.C2H6.H2/c1-7(2)10(6-5-9)8(3)4;1-2;/h7-8H,5-6,9H2,1-4H3;1-2H3;1H.
What are the key properties of N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen?
N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen has a molecular weight of 176.35 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-di(propan-2-yl)ethane-1,2-diamine;ethane;molecular hydrogen is sourced from PubChem (CID 142371506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).