C26H68N8 — CID 159329709
N',N'-diethylbutane-1,4-diamine;N',N'-diethylethane-1,2-diamine;N',N'-dimethylethane-1,2-diamine;N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 159329709) has the molecular formula C26H68N8 and a molecular weight of 492.89 g/mol. Its IUPAC name is N',N'-diethylbutane-1,4-diamine;N',N'-diethylethane-1,2-diamine;N',N'-dimethylethane-1,2-diamine;N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethylbutane-1,4-diamine;N',N'-diethylethane-1,2-diamine;N',N'-dimethylethane-1,2-diamine;N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 159329709 |
| Molecular Formula | C26H68N8 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.56 |
| IUPAC Name | N',N'-diethylbutane-1,4-diamine;N',N'-diethylethane-1,2-diamine;N',N'-dimethylethane-1,2-diamine;N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCN)C(C)C.CCN(CC)CCCCN.CCN(CC)CCN.CN(C)CCN |
| InChI | InChI=1S/2C8H20N2.C6H16N2.C4H12N2/c1-7(2)10(6-5-9)8(3)4;1-3-10(4-2)8-6-5-7-9;1-3-8(4-2)6-5-7;1-6(2)4-3-5/h7-8H,5-6,9H2,1-4H3;3-9H2,1-2H3;3-7H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | LEUZIZHPVJVQBM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|