C23H49N2O3PS — CID 58533901
S-[1-[2-bis[di(propan-2-yl)amino]phosphanyloxy-2-methylpropoxy]-2-methylpropan-2-yl] propanethioate (PubChem CID 58533901) has the molecular formula C23H49N2O3PS and a molecular weight of 464.70 g/mol. Its IUPAC name is S-[1-[2-bis[di(propan-2-yl)amino]phosphanyloxy-2-methylpropoxy]-2-methylpropan-2-yl] propanethioate.
| Compound Name | S-[1-[2-bis[di(propan-2-yl)amino]phosphanyloxy-2-methylpropoxy]-2-methylpropan-2-yl] propanethioate |
|---|---|
| PubChem CID | 58533901 |
| Molecular Formula | C23H49N2O3PS |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | S-[1-[2-bis[di(propan-2-yl)amino]phosphanyloxy-2-methylpropoxy]-2-methylpropan-2-yl] propanethioate |
| SMILES | CCC(=O)SC(C)(C)COCC(C)(C)OP(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H49N2O3PS/c1-14-21(26)30-23(12,13)16-27-15-22(10,11)28-29(24(17(2)3)18(4)5)25(19(6)7)20(8)9/h17-20H,14-16H2,1-13H3 |
| InChIKey | QZUSQLUXYAIKGL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|