C23H49N2O2PS2 — CID 58534074
S-[2-[1-bis[di(propan-2-yl)amino]phosphanylsulfanyl-2-methylpropan-2-yl]oxy-2-methylpropyl] propanethioate (PubChem CID 58534074) has the molecular formula C23H49N2O2PS2 and a molecular weight of 480.77 g/mol. Its IUPAC name is S-[2-[1-bis[di(propan-2-yl)amino]phosphanylsulfanyl-2-methylpropan-2-yl]oxy-2-methylpropyl] propanethioate.
| Compound Name | S-[2-[1-bis[di(propan-2-yl)amino]phosphanylsulfanyl-2-methylpropan-2-yl]oxy-2-methylpropyl] propanethioate |
|---|---|
| PubChem CID | 58534074 |
| Molecular Formula | C23H49N2O2PS2 |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | S-[2-[1-bis[di(propan-2-yl)amino]phosphanylsulfanyl-2-methylpropan-2-yl]oxy-2-methylpropyl] propanethioate |
| SMILES | CCC(=O)SCC(C)(C)OC(C)(C)CSP(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H49N2O2PS2/c1-14-21(26)29-15-22(10,11)27-23(12,13)16-30-28(24(17(2)3)18(4)5)25(19(6)7)20(8)9/h17-20H,14-16H2,1-13H3 |
| InChIKey | DKRXNPMBLAMGNT-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|