C23H48IN2O2PS2 — CID 163797126
S-[1-[1-bis[di(propan-2-yl)amino]phosphanylsulfanyl-2-methylpropan-2-yl]oxy-2-methylpropan-2-yl] 2-iodopropanethioate (PubChem CID 163797126) has the molecular formula C23H48IN2O2PS2 and a molecular weight of 606.66 g/mol. Its IUPAC name is S-[1-[1-bis[di(propan-2-yl)amino]phosphanylsulfanyl-2-methylpropan-2-yl]oxy-2-methylpropan-2-yl] 2-iodopropanethioate.
| Compound Name | S-[1-[1-bis[di(propan-2-yl)amino]phosphanylsulfanyl-2-methylpropan-2-yl]oxy-2-methylpropan-2-yl] 2-iodopropanethioate |
|---|---|
| PubChem CID | 163797126 |
| Molecular Formula | C23H48IN2O2PS2 |
| Molecular Weight | 606.66 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | S-[1-[1-bis[di(propan-2-yl)amino]phosphanylsulfanyl-2-methylpropan-2-yl]oxy-2-methylpropan-2-yl] 2-iodopropanethioate |
| SMILES | CC(I)C(=O)SC(C)(C)COC(C)(C)CSP(N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H48IN2O2PS2/c1-16(2)25(17(3)4)29(26(18(5)6)19(7)8)30-15-22(10,11)28-14-23(12,13)31-21(27)20(9)24/h16-20H,14-15H2,1-13H3 |
| InChIKey | NBTRMVWZEUMWBM-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.66 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|