C20H42NO4PS2 — CID 123220574
S-[2-[[di(propan-2-yl)amino]-[2-(1-hydroxy-2,2-dimethylpropyl)sulfanylethoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 123220574) has the molecular formula C20H42NO4PS2 and a molecular weight of 455.67 g/mol. Its IUPAC name is S-[2-[[di(propan-2-yl)amino]-[2-(1-hydroxy-2,2-dimethylpropyl)sulfanylethoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[di(propan-2-yl)amino]-[2-(1-hydroxy-2,2-dimethylpropyl)sulfanylethoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 123220574 |
| Molecular Formula | C20H42NO4PS2 |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | S-[2-[[di(propan-2-yl)amino]-[2-(1-hydroxy-2,2-dimethylpropyl)sulfanylethoxy]phosphanyl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)N(C(C)C)P(OCCSC(=O)C(C)(C)C)OCCSC(O)C(C)(C)C |
| InChI | InChI=1S/C20H42NO4PS2/c1-15(2)21(16(3)4)26(24-11-13-27-17(22)19(5,6)7)25-12-14-28-18(23)20(8,9)10/h15-17,22H,11-14H2,1-10H3 |
| InChIKey | ZKFILUITCNHLRU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|