C17H36N2O5P2 — CID 155378631
3-[[(2S)-6-dimethoxyphosphorylhexan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 155378631) has the molecular formula C17H36N2O5P2 and a molecular weight of 410.43 g/mol. Its IUPAC name is 3-[[(2S)-6-dimethoxyphosphorylhexan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2S)-6-dimethoxyphosphorylhexan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 155378631 |
| Molecular Formula | C17H36N2O5P2 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 3-[[(2S)-6-dimethoxyphosphorylhexan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COP(=O)(CCCC[C@H](C)OP(OCCC#N)N(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C17H36N2O5P2/c1-15(2)19(16(3)4)25(23-13-10-12-18)24-17(5)11-8-9-14-26(20,21-6)22-7/h15-17H,8-11,13-14H2,1-7H3/t17-,25?/m0/s1 |
| InChIKey | ZNZOJQWPAQDYQW-LFUZPPSTSA-N |
| XLogP | 5.32 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|