C15H30N2O5P2 — CID 155378697
3-[[(E)-4-dimethoxyphosphorylbut-3-enoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 155378697) has the molecular formula C15H30N2O5P2 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3-[[(E)-4-dimethoxyphosphorylbut-3-enoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(E)-4-dimethoxyphosphorylbut-3-enoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 155378697 |
| Molecular Formula | C15H30N2O5P2 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3-[[(E)-4-dimethoxyphosphorylbut-3-enoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COP(=O)(/C=C/CCOP(OCCC#N)N(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C15H30N2O5P2/c1-14(2)17(15(3)4)23(22-12-9-10-16)21-11-7-8-13-24(18,19-5)20-6/h8,13-15H,7,9,11-12H2,1-6H3/b13-8+ |
| InChIKey | DTZHXPRYVBQMMK-MDWZMJQESA-N |
| XLogP | 4.67 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|