C20H30N3O4P — CID 158653354
2-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanoyl]-N-methylbenzamide (PubChem CID 158653354) has the molecular formula C20H30N3O4P and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanoyl]-N-methylbenzamide.
| Compound Name | 2-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 158653354 |
| Molecular Formula | C20H30N3O4P |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanoyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1C(=O)CCOP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H30N3O4P/c1-15(2)23(16(3)4)28(26-13-8-12-21)27-14-11-19(24)17-9-6-7-10-18(17)20(25)22-5/h6-7,9-10,15-16H,8,11,13-14H2,1-5H3,(H,22,25) |
| InChIKey | IBVBIRIVKSYMPW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|