C27H38N5O4P — CID 163974028
N-[(2S,3S)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-methoxybutan-2-yl]-4-phenyldiazenylbenzamide (PubChem CID 163974028) has the molecular formula C27H38N5O4P and a molecular weight of 527.61 g/mol. Its IUPAC name is N-[(2S,3S)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-methoxybutan-2-yl]-4-phenyldiazenylbenzamide.
| Compound Name | N-[(2S,3S)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-methoxybutan-2-yl]-4-phenyldiazenylbenzamide |
|---|---|
| PubChem CID | 163974028 |
| Molecular Formula | C27H38N5O4P |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-[(2S,3S)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-1-methoxybutan-2-yl]-4-phenyldiazenylbenzamide |
| SMILES | COC[C@H](NC(=O)c1ccc(/N=N/c2ccccc2)cc1)[C@H](C)OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C27H38N5O4P/c1-20(2)32(21(3)4)37(35-18-10-17-28)36-22(5)26(19-34-6)29-27(33)23-13-15-25(16-14-23)31-30-24-11-8-7-9-12-24/h7-9,11-16,20-22,26H,10,18-19H2,1-6H3,(H,29,33)/b31-30+/t22-,26-,37?/m0/s1 |
| InChIKey | SSMUMWPBYAIPEM-SZUHDRTGSA-N |
| XLogP | 6.53 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|