C30H42N3O6P — CID 135010561
N-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzamide (PubChem CID 135010561) has the molecular formula C30H42N3O6P and a molecular weight of 571.66 g/mol. Its IUPAC name is N-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzamide.
| Compound Name | N-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzamide |
|---|---|
| PubChem CID | 135010561 |
| Molecular Formula | C30H42N3O6P |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | N-[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropyl]-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzamide |
| SMILES | COc1cc(/C=C/c2ccc(C(=O)NCCCOP(OCCC#N)N(C(C)C)C(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H42N3O6P/c1-22(2)33(23(3)4)40(38-18-8-16-31)39-19-9-17-32-30(34)26-14-12-24(13-15-26)10-11-25-20-27(35-5)29(37-7)28(21-25)36-6/h10-15,20-23H,8-9,17-19H2,1-7H3,(H,32,34)/b11-10+ |
| InChIKey | MHLTTXDABHJESN-ZHACJKMWSA-N |
| XLogP | 6.30 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|