C30H44N3O7P — CID 102464746
[3-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexylcarbamoyl]-2-oxochromen-7-yl] 2,2-dimethylpropanoate (PubChem CID 102464746) has the molecular formula C30H44N3O7P and a molecular weight of 589.67 g/mol. Its IUPAC name is [3-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexylcarbamoyl]-2-oxochromen-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexylcarbamoyl]-2-oxochromen-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102464746 |
| Molecular Formula | C30H44N3O7P |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | [3-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexylcarbamoyl]-2-oxochromen-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCCCCCNC(=O)c1cc2ccc(OC(=O)C(C)(C)C)cc2oc1=O |
| InChI | InChI=1S/C30H44N3O7P/c1-21(2)33(22(3)4)41(38-18-12-15-31)37-17-11-9-8-10-16-32-27(34)25-19-23-13-14-24(20-26(23)40-28(25)35)39-29(36)30(5,6)7/h13-14,19-22H,8-12,16-18H2,1-7H3,(H,32,34) |
| InChIKey | NPJILJXMMUDWMF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 131.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|