C40H47N2O9P — CID 10818709
[5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-6'-(2,2-dimethylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate (PubChem CID 10818709) has the molecular formula C40H47N2O9P and a molecular weight of 730.79 g/mol. Its IUPAC name is [5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-6'-(2,2-dimethylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate.
| Compound Name | [5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-6'-(2,2-dimethylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10818709 |
| Molecular Formula | C40H47N2O9P |
| Molecular Weight | 730.79 g/mol |
| Exact Mass | 730.30 |
| IUPAC Name | [5-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-6'-(2,2-dimethylpropanoyloxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCc1ccc2c(c1)C(=O)OC21c2ccc(OC(=O)C(C)(C)C)cc2Oc2cc(OC(=O)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C40H47N2O9P/c1-24(2)42(25(3)4)52(46-19-11-18-41)47-23-26-12-15-30-29(20-26)35(43)51-40(30)31-16-13-27(48-36(44)38(5,6)7)21-33(31)50-34-22-28(14-17-32(34)40)49-37(45)39(8,9)10/h12-17,20-22,24-25H,11,19,23H2,1-10H3 |
| InChIKey | ODLHCNSQMAPNQO-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 133.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.79 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|