C27H24O4 — CID 121431695
(5-methyl-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-2'-yl) 2,2-dimethylpropanoate (PubChem CID 121431695) has the molecular formula C27H24O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (5-methyl-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-2'-yl) 2,2-dimethylpropanoate.
| Compound Name | (5-methyl-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-2'-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 121431695 |
| Molecular Formula | C27H24O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (5-methyl-3-oxospiro[2-benzofuran-1,10'-9H-anthracene]-2'-yl) 2,2-dimethylpropanoate |
| SMILES | Cc1ccc2c(c1)C(=O)OC21c2ccccc2Cc2cc(OC(=O)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C27H24O4/c1-16-9-11-23-20(13-16)24(28)31-27(23)21-8-6-5-7-17(21)14-18-15-19(10-12-22(18)27)30-25(29)26(2,3)4/h5-13,15H,14H2,1-4H3 |
| InChIKey | DMGSTIBBHIGLDK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|