C38H40O13 — CID 134240591
4-O-[5-tert-butyl-6'-[4-(2-methoxyethoxy)-4-oxobutanoyl]oxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 1-O-(2-methoxyethyl) butanedioate (PubChem CID 134240591) has the molecular formula C38H40O13 and a molecular weight of 704.72 g/mol. Its IUPAC name is 4-O-[5-tert-butyl-6'-[4-(2-methoxyethoxy)-4-oxobutanoyl]oxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 1-O-(2-methoxyethyl) butanedioate.
| Compound Name | 4-O-[5-tert-butyl-6'-[4-(2-methoxyethoxy)-4-oxobutanoyl]oxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 1-O-(2-methoxyethyl) butanedioate |
|---|---|
| PubChem CID | 134240591 |
| Molecular Formula | C38H40O13 |
| Molecular Weight | 704.72 g/mol |
| Exact Mass | 704.25 |
| IUPAC Name | 4-O-[5-tert-butyl-6'-[4-(2-methoxyethoxy)-4-oxobutanoyl]oxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 1-O-(2-methoxyethyl) butanedioate |
| SMILES | COCCOC(=O)CCC(=O)Oc1ccc2c(c1)Oc1cc(OC(=O)CCC(=O)OCCOC)ccc1C21OC(=O)c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C38H40O13/c1-37(2,3)23-6-9-27-26(20-23)36(43)51-38(27)28-10-7-24(48-34(41)14-12-32(39)46-18-16-44-4)21-30(28)50-31-22-25(8-11-29(31)38)49-35(42)15-13-33(40)47-19-17-45-5/h6-11,20-22H,12-19H2,1-5H3 |
| InChIKey | SJPYYWQWUKJZIT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|