C24H22N2O3 — CID 135302676
3',6'-diamino-6-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 135302676) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3',6'-diamino-6-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-diamino-6-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 135302676 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3',6'-diamino-6-tert-butylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CC(C)(C)c1ccc2c(c1)C(=O)OC21c2ccc(N)cc2Oc2cc(N)ccc21 |
| InChI | InChI=1S/C24H22N2O3/c1-23(2,3)13-4-7-17-16(10-13)22(27)29-24(17)18-8-5-14(25)11-20(18)28-21-12-15(26)6-9-19(21)24/h4-12H,25-26H2,1-3H3 |
| InChIKey | OMOSLNOWRAXLCK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|