C26H24BNO6 — CID 153386911
5-amino-3'-hydroxy-6'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 153386911) has the molecular formula C26H24BNO6 and a molecular weight of 457.29 g/mol. Its IUPAC name is 5-amino-3'-hydroxy-6'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 5-amino-3'-hydroxy-6'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 153386911 |
| Molecular Formula | C26H24BNO6 |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 5-amino-3'-hydroxy-6'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)Oc2cc(O)ccc2C32OC(=O)c3ccc(N)cc32)OC1(C)C |
| InChI | InChI=1S/C26H24BNO6/c1-24(2)25(3,4)34-27(33-24)14-5-9-18-21(11-14)31-22-13-16(29)7-10-19(22)26(18)20-12-15(28)6-8-17(20)23(30)32-26/h5-13,29H,28H2,1-4H3 |
| InChIKey | GXGDDBHUZOUDKC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|