C29H26N2O4 — CID 143870788
3'-(4-amino-N-methylanilino)-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;ethane (PubChem CID 143870788) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 3'-(4-amino-N-methylanilino)-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;ethane.
| Compound Name | 3'-(4-amino-N-methylanilino)-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;ethane |
|---|---|
| PubChem CID | 143870788 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 3'-(4-amino-N-methylanilino)-6'-hydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;ethane |
| SMILES | CC.CN(c1ccc(N)cc1)c1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C27H20N2O4.C2H6/c1-29(17-8-6-16(28)7-9-17)18-10-12-22-24(14-18)32-25-15-19(30)11-13-23(25)27(22)21-5-3-2-4-20(21)26(31)33-27;1-2/h2-15,30H,28H2,1H3;1-2H3 |
| InChIKey | HRUZFOZSDVOIHA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|