C28H23NO6 — CID 66603289
4-(2-aminoethyl)phenol;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 66603289) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is 4-(2-aminoethyl)phenol;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 4-(2-aminoethyl)phenol;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 66603289 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 4-(2-aminoethyl)phenol;3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | NCCc1ccc(O)cc1.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C20H12O5.C8H11NO/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20;9-6-5-7-1-3-8(10)4-2-7/h1-10,21-22H;1-4,10H,5-6,9H2 |
| InChIKey | UAWZYHMFZTXRAM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |