C28H17F6NO3 — CID 175150423
3,3-bis[4-(trifluoromethyl)phenyl]-2-benzofuran-1-one;7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-amine (PubChem CID 175150423) has the molecular formula C28H17F6NO3 and a molecular weight of 529.44 g/mol. Its IUPAC name is 3,3-bis[4-(trifluoromethyl)phenyl]-2-benzofuran-1-one;7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-amine.
| Compound Name | 3,3-bis[4-(trifluoromethyl)phenyl]-2-benzofuran-1-one;7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-amine |
|---|---|
| PubChem CID | 175150423 |
| Molecular Formula | C28H17F6NO3 |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 3,3-bis[4-(trifluoromethyl)phenyl]-2-benzofuran-1-one;7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-amine |
| SMILES | Nc1ccc2c(c1)O2.O=C1OC(c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H12F6O2.C6H5NO/c23-21(24,25)15-9-5-13(6-10-15)20(14-7-11-16(12-8-14)22(26,27)28)18-4-2-1-3-17(18)19(29)30-20;7-4-1-2-5-6(3-4)8-5/h1-12H;1-3H,7H2 |
| InChIKey | KSFXIVHVEHRQAB-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|