C30H18Cl2F3NO5 — CID 143870784
[2',7'-dichloro-6'-[N-methyl-4-(trifluoromethyl)anilino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate (PubChem CID 143870784) has the molecular formula C30H18Cl2F3NO5 and a molecular weight of 600.38 g/mol. Its IUPAC name is [2',7'-dichloro-6'-[N-methyl-4-(trifluoromethyl)anilino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate.
| Compound Name | [2',7'-dichloro-6'-[N-methyl-4-(trifluoromethyl)anilino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
|---|---|
| PubChem CID | 143870784 |
| Molecular Formula | C30H18Cl2F3NO5 |
| Molecular Weight | 600.38 g/mol |
| Exact Mass | 599.05 |
| IUPAC Name | [2',7'-dichloro-6'-[N-methyl-4-(trifluoromethyl)anilino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1Cl)C1(OC(=O)c3ccccc31)c1cc(Cl)c(N(C)c3ccc(C(F)(F)F)cc3)cc1O2 |
| InChI | InChI=1S/C30H18Cl2F3NO5/c1-15(37)39-27-14-26-21(12-23(27)32)29(19-6-4-3-5-18(19)28(38)41-29)20-11-22(31)24(13-25(20)40-26)36(2)17-9-7-16(8-10-17)30(33,34)35/h3-14H,1-2H3 |
| InChIKey | XOCJMEJVZVWEDD-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.38 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|