C36H58NO6P — CID 144939586
but-1-ene;[4-[[[4-(2,2-dimethylpropanoyloxy)phenyl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]phenyl] 2,2-dimethylpropanoate;ethane (PubChem CID 144939586) has the molecular formula C36H58NO6P and a molecular weight of 631.84 g/mol. Its IUPAC name is but-1-ene;[4-[[[4-(2,2-dimethylpropanoyloxy)phenyl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]phenyl] 2,2-dimethylpropanoate;ethane.
| Compound Name | but-1-ene;[4-[[[4-(2,2-dimethylpropanoyloxy)phenyl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]phenyl] 2,2-dimethylpropanoate;ethane |
|---|---|
| PubChem CID | 144939586 |
| Molecular Formula | C36H58NO6P |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.40 |
| IUPAC Name | but-1-ene;[4-[[[4-(2,2-dimethylpropanoyloxy)phenyl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]phenyl] 2,2-dimethylpropanoate;ethane |
| SMILES | C=CCC.CC.CC(C)N(C(C)C)P(OCc1ccc(OC(=O)C(C)(C)C)cc1)OCc1ccc(OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H44NO6P.C4H8.C2H6/c1-21(2)31(22(3)4)38(34-19-23-11-15-25(16-12-23)36-27(32)29(5,6)7)35-20-24-13-17-26(18-14-24)37-28(33)30(8,9)10;1-3-4-2;1-2/h11-18,21-22H,19-20H2,1-10H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | RMFGMVMPWTZVNH-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|