C26H34N3O4P — CID 54069031
9H-fluoren-9-ylmethyl 2-amino-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanoate (PubChem CID 54069031) has the molecular formula C26H34N3O4P and a molecular weight of 483.55 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-amino-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-amino-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanoate |
|---|---|
| PubChem CID | 54069031 |
| Molecular Formula | C26H34N3O4P |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-amino-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanoate |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC(N)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H34N3O4P/c1-18(2)29(19(3)4)34(32-15-9-14-27)33-17-25(28)26(30)31-16-24-22-12-7-5-10-20(22)21-11-6-8-13-23(21)24/h5-8,10-13,18-19,24-25H,9,15-17,28H2,1-4H3 |
| InChIKey | MFBKVSDHOVSFTB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|