C57H92BN7O10P2S4 — CID 159135242
CID 159135242 (PubChem CID 159135242) has the molecular formula C57H92BN7O10P2S4 and a molecular weight of 1236.43 g/mol.
| Compound Name | CID 159135242 |
|---|---|
| PubChem CID | 159135242 |
| Molecular Formula | C57H92BN7O10P2S4 |
| Molecular Weight | 1236.43 g/mol |
| Exact Mass | 1235.54 |
| IUPAC Name | — |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC(CSSC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21.[B]C1CC(OP(OCCC#N)N(C(C)C)C(C)C)C(CNC(=O)C(CSSC(C)(C)C)NC(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C31H44N3O4PS2.C26H48BN4O6PS2/c1-22(2)34(23(3)4)39(37-18-12-17-32)38-19-24(21-40-41-31(5,6)7)33-30(35)36-20-29-27-15-10-8-13-25(27)26-14-9-11-16-28(26)29;1-17(2)31(18(3)4)38(34-13-11-12-28)37-20-14-22(27)35-21(20)15-29-23(32)19(16-39-40-26(8,9)10)30-24(33)36-25(5,6)7/h8-11,13-16,22-24,29H,12,18-21H2,1-7H3,(H,33,35);17-22H,11,13-16H2,1-10H3,(H,29,32)(H,30,33) |
| InChIKey | NVRHQWAQJWWFJH-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 205.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1236.43 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|