C73H103N2O16P — CID 87415692
2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;bis([2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-diphenylmethyl]benzene) (PubChem CID 87415692) has the molecular formula C73H103N2O16P and a molecular weight of 1295.60 g/mol. Its IUPAC name is 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;bis([2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-diphenylmethyl]benzene).
| Compound Name | 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;bis([2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-diphenylmethyl]benzene) |
|---|---|
| PubChem CID | 87415692 |
| Molecular Formula | C73H103N2O16P |
| Molecular Weight | 1295.60 g/mol |
| Exact Mass | 1294.70 |
| IUPAC Name | 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid;bis([2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy-diphenylmethyl]benzene) |
| SMILES | CC(C)N(C(C)C)P(O)OCCC#N.COCCOCCOCCOCCOCCOCCOC(c1ccccc1)(c1ccccc1)c1ccccc1.COCCOCCOCCOCCOCCOCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C32H42O7.C9H19N2O2P/c2*1-33-17-18-34-19-20-35-21-22-36-23-24-37-25-26-38-27-28-39-32(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31;1-8(2)11(9(3)4)14(12)13-7-5-6-10/h2*2-16H,17-28H2,1H3;8-9,12H,5,7H2,1-4H3 |
| InChIKey | QQCSAEJBVGZGKH-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 185.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1295.60 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|