C37H51N2O5PS2 — CID 175842814
3-[3-[bis(4-methoxyphenyl)-phenylmethoxy]propyldisulfanyl]butoxy-N-(4-cyano-2-methylbutan-2-yl)-N-propan-2-ylphosphonamidous acid (PubChem CID 175842814) has the molecular formula C37H51N2O5PS2 and a molecular weight of 698.93 g/mol. Its IUPAC name is 3-[3-[bis(4-methoxyphenyl)-phenylmethoxy]propyldisulfanyl]butoxy-N-(4-cyano-2-methylbutan-2-yl)-N-propan-2-ylphosphonamidous acid.
| Compound Name | 3-[3-[bis(4-methoxyphenyl)-phenylmethoxy]propyldisulfanyl]butoxy-N-(4-cyano-2-methylbutan-2-yl)-N-propan-2-ylphosphonamidous acid |
|---|---|
| PubChem CID | 175842814 |
| Molecular Formula | C37H51N2O5PS2 |
| Molecular Weight | 698.93 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | 3-[3-[bis(4-methoxyphenyl)-phenylmethoxy]propyldisulfanyl]butoxy-N-(4-cyano-2-methylbutan-2-yl)-N-propan-2-ylphosphonamidous acid |
| SMILES | COc1ccc(C(OCCCSSC(C)CCOP(O)N(C(C)C)C(C)(C)CCC#N)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H51N2O5PS2/c1-29(2)39(36(4,5)24-11-25-38)45(40)44-27-23-30(3)47-46-28-12-26-43-37(31-13-9-8-10-14-31,32-15-19-34(41-6)20-16-32)33-17-21-35(42-7)22-18-33/h8-10,13-22,29-30,40H,11-12,23-24,26-28H2,1-7H3 |
| InChIKey | AZFPKUNIRLORPK-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.93 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|