C38H50BN2O5PS — CID 174031581
CID 174031581 (PubChem CID 174031581) has the molecular formula C38H50BN2O5PS and a molecular weight of 688.68 g/mol.
| Compound Name | CID 174031581 |
|---|---|
| PubChem CID | 174031581 |
| Molecular Formula | C38H50BN2O5PS |
| Molecular Weight | 688.68 g/mol |
| Exact Mass | 688.33 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1S[C@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)[C@@H]([C@@H](C)P(OCCC#N)N(C(C)C)C(C)C)[C@H]1OC |
| InChI | InChI=1S/C38H50BN2O5PS/c1-26(2)41(27(3)4)47(46-24-12-23-40)28(5)35-34(48-37(39)36(35)44-8)25-45-38(29-13-10-9-11-14-29,30-15-19-32(42-6)20-16-30)31-17-21-33(43-7)22-18-31/h9-11,13-22,26-28,34-37H,12,24-25H2,1-8H3/t28-,34-,35-,36-,37-,47?/m1/s1 |
| InChIKey | GAXXTQIKLXMHDL-UFNSURRCSA-N |
| XLogP | 8.00 |
| TPSA | 73.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.68 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|