C14H30N3O3P — CID 138485326
3-[(4-amino-2-methoxybutoxy)-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 138485326) has the molecular formula C14H30N3O3P and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-[(4-amino-2-methoxybutoxy)-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[(4-amino-2-methoxybutoxy)-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 138485326 |
| Molecular Formula | C14H30N3O3P |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 3-[(4-amino-2-methoxybutoxy)-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COC(CCN)COP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H30N3O3P/c1-12(2)17(13(3)4)21(19-10-6-8-15)20-11-14(18-5)7-9-16/h12-14H,6-7,9-11,16H2,1-5H3 |
| InChIKey | XGZXHWQAHZOVKR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|