C14H25N2O2P — CID 153336220
3-[1-bicyclo[1.1.1]pentanyloxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 153336220) has the molecular formula C14H25N2O2P and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-[1-bicyclo[1.1.1]pentanyloxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[1-bicyclo[1.1.1]pentanyloxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 153336220 |
| Molecular Formula | C14H25N2O2P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-[1-bicyclo[1.1.1]pentanyloxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC12CC(C1)C2 |
| InChI | InChI=1S/C14H25N2O2P/c1-11(2)16(12(3)4)19(17-7-5-6-15)18-14-8-13(9-14)10-14/h11-13H,5,7-10H2,1-4H3 |
| InChIKey | VQVGXKZPZJSJHK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|