C16H31N2O4P — CID 58590317
3-[[di(propan-2-yl)amino]-[(3R,4R)-2-ethyl-4-hydroxy-5-methyloxolan-3-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 58590317) has the molecular formula C16H31N2O4P and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[(3R,4R)-2-ethyl-4-hydroxy-5-methyloxolan-3-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[(3R,4R)-2-ethyl-4-hydroxy-5-methyloxolan-3-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 58590317 |
| Molecular Formula | C16H31N2O4P |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[(3R,4R)-2-ethyl-4-hydroxy-5-methyloxolan-3-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | CCC1OC(C)[C@@H](O)[C@H]1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H31N2O4P/c1-7-14-16(15(19)13(6)21-14)22-23(20-10-8-9-17)18(11(2)3)12(4)5/h11-16,19H,7-8,10H2,1-6H3/t13?,14?,15-,16+,23?/m1/s1 |
| InChIKey | LHVQULHRIAKJMZ-SSJSQEDASA-N |
| XLogP | 3.21 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|