C22H37N2O9P — CID 58664507
[3,4-diacetyloxy-6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-methyloxan-2-yl]methyl acetate (PubChem CID 58664507) has the molecular formula C22H37N2O9P and a molecular weight of 504.52 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58664507 |
| Molecular Formula | C22H37N2O9P |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | [3,4-diacetyloxy-6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OP(OCCC#N)N(C(C)C)C(C)C)C(C)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H37N2O9P/c1-13(2)24(14(3)4)34(29-11-9-10-23)33-22-15(5)20(30-17(7)26)21(31-18(8)27)19(32-22)12-28-16(6)25/h13-15,19-22H,9,11-12H2,1-8H3 |
| InChIKey | YFTUACIZMKDUDQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 133.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|