C17H31N2O5P — CID 23562405
[2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-4-methyloxolan-3-yl] acetate (PubChem CID 23562405) has the molecular formula C17H31N2O5P and a molecular weight of 374.42 g/mol. Its IUPAC name is [2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-4-methyloxolan-3-yl] acetate.
| Compound Name | [2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 23562405 |
| Molecular Formula | C17H31N2O5P |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | [2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-4-methyloxolan-3-yl] acetate |
| SMILES | CC(=O)OC1C(C)COC1COP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C17H31N2O5P/c1-12(2)19(13(3)4)25(22-9-7-8-18)23-11-16-17(24-15(6)20)14(5)10-21-16/h12-14,16-17H,7,9-11H2,1-6H3 |
| InChIKey | JZNJLGLODCJQTI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|