C17H33N4O3P — CID 140513434
N-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethyl]piperidine-4-carboxamide (PubChem CID 140513434) has the molecular formula C17H33N4O3P and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethyl]piperidine-4-carboxamide.
| Compound Name | N-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 140513434 |
| Molecular Formula | C17H33N4O3P |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | N-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethyl]piperidine-4-carboxamide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCNC(=O)C1CCNCC1 |
| InChI | InChI=1S/C17H33N4O3P/c1-14(2)21(15(3)4)25(23-12-5-8-18)24-13-11-20-17(22)16-6-9-19-10-7-16/h14-16,19H,5-7,9-13H2,1-4H3,(H,20,22) |
| InChIKey | XUKUXXXMSCJKQV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|