C27H46N3O11P — CID 142588185
[(3R)-5-acetamido-3,4-diacetyloxy-6-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutoxy]oxan-2-yl]methyl acetate (PubChem CID 142588185) has the molecular formula C27H46N3O11P and a molecular weight of 619.65 g/mol. Its IUPAC name is [(3R)-5-acetamido-3,4-diacetyloxy-6-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(3R)-5-acetamido-3,4-diacetyloxy-6-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142588185 |
| Molecular Formula | C27H46N3O11P |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | [(3R)-5-acetamido-3,4-diacetyloxy-6-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(OCCCCOP(OCCC#N)N(C(C)C)C(C)C)OC(COC(C)=O)[C@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C27H46N3O11P/c1-17(2)30(18(3)4)42(38-15-11-12-28)37-14-10-9-13-35-27-24(29-19(5)31)26(40-22(8)34)25(39-21(7)33)23(41-27)16-36-20(6)32/h17-18,23-27H,9-11,13-16H2,1-8H3,(H,29,31)/t23?,24?,25-,26?,27?,42?/m0/s1 |
| InChIKey | PINRSXYLRGQIGY-RBMWPKHDSA-N |
| XLogP | 2.73 |
| TPSA | 171.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|