C29H54N3O7P — CID 159258042
[(4R,5S,6R)-6-[6-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropylamino]-6-oxohexoxy]-3,4,5-trimethyloxan-2-yl]methyl acetate (PubChem CID 159258042) has the molecular formula C29H54N3O7P and a molecular weight of 587.74 g/mol. Its IUPAC name is [(4R,5S,6R)-6-[6-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropylamino]-6-oxohexoxy]-3,4,5-trimethyloxan-2-yl]methyl acetate.
| Compound Name | [(4R,5S,6R)-6-[6-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropylamino]-6-oxohexoxy]-3,4,5-trimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 159258042 |
| Molecular Formula | C29H54N3O7P |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.37 |
| IUPAC Name | [(4R,5S,6R)-6-[6-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropylamino]-6-oxohexoxy]-3,4,5-trimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OCCCCCC(=O)NCC(C)OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C29H54N3O7P/c1-20(2)32(21(3)4)40(37-17-13-15-30)39-22(5)18-31-28(34)14-11-10-12-16-35-29-25(8)23(6)24(7)27(38-29)19-36-26(9)33/h20-25,27,29H,10-14,16-19H2,1-9H3,(H,31,34)/t22?,23-,24?,25+,27?,29-,40?/m1/s1 |
| InChIKey | KNMZSLAPHGCISR-HFNJLUHXSA-N |
| XLogP | 5.56 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|