C14H27N2O3PS2 — CID 164565439
3-[[di(propan-2-yl)amino]-[(4R,5R)-5-methoxydithian-4-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 164565439) has the molecular formula C14H27N2O3PS2 and a molecular weight of 366.49 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[(4R,5R)-5-methoxydithian-4-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[(4R,5R)-5-methoxydithian-4-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 164565439 |
| Molecular Formula | C14H27N2O3PS2 |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[(4R,5R)-5-methoxydithian-4-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | CO[C@H]1CSSC[C@@H]1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H27N2O3PS2/c1-11(2)16(12(3)4)20(18-8-6-7-15)19-14-10-22-21-9-13(14)17-5/h11-14H,6,8-10H2,1-5H3/t13-,14-,20?/m0/s1 |
| InChIKey | HHNKCOMFDODQKB-JWDIZXQDSA-N |
| XLogP | 4.06 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|