C16H29N2O4PS2 — CID 170710563
methyl (3R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolane-3-carboxylate (PubChem CID 170710563) has the molecular formula C16H29N2O4PS2 and a molecular weight of 408.53 g/mol. Its IUPAC name is methyl (3R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolane-3-carboxylate.
| Compound Name | methyl (3R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolane-3-carboxylate |
|---|---|
| PubChem CID | 170710563 |
| Molecular Formula | C16H29N2O4PS2 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | methyl (3R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1SSC(C)(C)C1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H29N2O4PS2/c1-11(2)18(12(3)4)23(21-10-8-9-17)22-14-13(15(19)20-7)24-25-16(14,5)6/h11-14H,8,10H2,1-7H3/t13-,14?,23?/m1/s1 |
| InChIKey | XMEFUCVVBHWODU-CAOLDBJHSA-N |
| XLogP | 4.36 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|