C29H37N2O6PS2 — CID 167155499
[3-benzoyloxy-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolan-3-yl]methyl benzoate (PubChem CID 167155499) has the molecular formula C29H37N2O6PS2 and a molecular weight of 604.73 g/mol. Its IUPAC name is [3-benzoyloxy-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolan-3-yl]methyl benzoate.
| Compound Name | [3-benzoyloxy-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolan-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 167155499 |
| Molecular Formula | C29H37N2O6PS2 |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | [3-benzoyloxy-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolan-3-yl]methyl benzoate |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(C)(C)SSC1(COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H37N2O6PS2/c1-21(2)31(22(3)4)38(35-19-13-18-30)37-27-28(5,6)39-40-29(27,36-26(33)24-16-11-8-12-17-24)20-34-25(32)23-14-9-7-10-15-23/h7-12,14-17,21-22,27H,13,19-20H2,1-6H3 |
| InChIKey | HDEJMDUHWFKIJM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|