C22H35N2O6PS4 — CID 170710539
3-[[3,3-bis(methylsulfonylmethyl)-5-phenyldithiolan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 170710539) has the molecular formula C22H35N2O6PS4 and a molecular weight of 582.77 g/mol. Its IUPAC name is 3-[[3,3-bis(methylsulfonylmethyl)-5-phenyldithiolan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[3,3-bis(methylsulfonylmethyl)-5-phenyldithiolan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 170710539 |
| Molecular Formula | C22H35N2O6PS4 |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 3-[[3,3-bis(methylsulfonylmethyl)-5-phenyldithiolan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(c2ccccc2)SSC1(CS(C)(=O)=O)CS(C)(=O)=O |
| InChI | InChI=1S/C22H35N2O6PS4/c1-17(2)24(18(3)4)31(29-14-10-13-23)30-21-20(19-11-8-7-9-12-19)32-33-22(21,15-34(5,25)26)16-35(6,27)28/h7-9,11-12,17-18,20-21H,10,14-16H2,1-6H3 |
| InChIKey | QVUIHLGPTSINSW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 113.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|