C23H44N3O2PS2 — CID 170710667
3-[[7-(4-amino-2,2,4-trimethylpentyl)-5,6-dithiaspiro[3.4]octan-8-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 170710667) has the molecular formula C23H44N3O2PS2 and a molecular weight of 489.73 g/mol. Its IUPAC name is 3-[[7-(4-amino-2,2,4-trimethylpentyl)-5,6-dithiaspiro[3.4]octan-8-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[7-(4-amino-2,2,4-trimethylpentyl)-5,6-dithiaspiro[3.4]octan-8-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 170710667 |
| Molecular Formula | C23H44N3O2PS2 |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 3-[[7-(4-amino-2,2,4-trimethylpentyl)-5,6-dithiaspiro[3.4]octan-8-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(CC(C)(C)CC(C)(C)N)SSC12CCC2 |
| InChI | InChI=1S/C23H44N3O2PS2/c1-17(2)26(18(3)4)29(27-14-10-13-24)28-20-19(30-31-23(20)11-9-12-23)15-21(5,6)16-22(7,8)25/h17-20H,9-12,14-16,25H2,1-8H3 |
| InChIKey | AULUDTSMTKSLKM-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|