C15H29N2O3PS2 — CID 167155477
3-[[di(propan-2-yl)amino]-[(4R,5S)-5-hydroxydithiocan-4-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 167155477) has the molecular formula C15H29N2O3PS2 and a molecular weight of 380.52 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[(4R,5S)-5-hydroxydithiocan-4-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[(4R,5S)-5-hydroxydithiocan-4-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 167155477 |
| Molecular Formula | C15H29N2O3PS2 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[(4R,5S)-5-hydroxydithiocan-4-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)O[C@H]1CSSCCC[C@@H]1O |
| InChI | InChI=1S/C15H29N2O3PS2/c1-12(2)17(13(3)4)21(19-9-6-8-16)20-15-11-23-22-10-5-7-14(15)18/h12-15,18H,5-7,9-11H2,1-4H3/t14-,15-,21?/m0/s1 |
| InChIKey | MDJLJPFLTGMEEG-CJUKTHODSA-N |
| XLogP | 4.18 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|