C16H25N4O2PS2 — CID 170710786
(4S)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolane-3,3-dicarbonitrile (PubChem CID 170710786) has the molecular formula C16H25N4O2PS2 and a molecular weight of 400.51 g/mol. Its IUPAC name is (4S)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolane-3,3-dicarbonitrile.
| Compound Name | (4S)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolane-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 170710786 |
| Molecular Formula | C16H25N4O2PS2 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (4S)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5,5-dimethyldithiolane-3,3-dicarbonitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)O[C@H]1C(C)(C)SSC1(C#N)C#N |
| InChI | InChI=1S/C16H25N4O2PS2/c1-12(2)20(13(3)4)23(21-9-7-8-17)22-14-15(5,6)24-25-16(14,10-18)11-19/h12-14H,7,9H2,1-6H3/t14-,23?/m0/s1 |
| InChIKey | SPSUHROLODAKDE-JRQMZCAUSA-N |
| XLogP | 4.61 |
| TPSA | 93.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|