C43H53N2O7P — CID 102030990
3-[[di(propan-2-yl)amino]-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 102030990) has the molecular formula C43H53N2O7P and a molecular weight of 740.88 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 102030990 |
| Molecular Formula | C43H53N2O7P |
| Molecular Weight | 740.88 g/mol |
| Exact Mass | 740.36 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)O[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H53N2O7P/c1-33(2)45(34(3)4)53(50-27-17-26-44)52-43-42(49-31-38-24-15-8-16-25-38)41(48-30-37-22-13-7-14-23-37)40(47-29-36-20-11-6-12-21-36)39(51-43)32-46-28-35-18-9-5-10-19-35/h5-16,18-25,33-34,39-43H,17,27-32H2,1-4H3/t39-,40+,41+,42-,43-,53?/m1/s1 |
| InChIKey | AMYJWKNFCAPSPN-ZVNQLMPVSA-N |
| XLogP | 8.98 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.88 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|