C22H35N2O4PS2 — CID 164565465
3-[[(4S,5R)-5-(2,4-dimethoxyphenyl)-3,3-dimethyldithiolan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 164565465) has the molecular formula C22H35N2O4PS2 and a molecular weight of 486.64 g/mol. Its IUPAC name is 3-[[(4S,5R)-5-(2,4-dimethoxyphenyl)-3,3-dimethyldithiolan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(4S,5R)-5-(2,4-dimethoxyphenyl)-3,3-dimethyldithiolan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 164565465 |
| Molecular Formula | C22H35N2O4PS2 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-[[(4S,5R)-5-(2,4-dimethoxyphenyl)-3,3-dimethyldithiolan-4-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc([C@H]2SSC(C)(C)[C@H]2OP(OCCC#N)N(C(C)C)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C22H35N2O4PS2/c1-15(2)24(16(3)4)29(27-13-9-12-23)28-21-20(30-31-22(21,5)6)18-11-10-17(25-7)14-19(18)26-8/h10-11,14-16,20-21H,9,13H2,1-8H3/t20-,21+,29?/m1/s1 |
| InChIKey | XCXWHHPBTNZSOG-AVNYNHNVSA-N |
| XLogP | 6.58 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|