C18H34N3O4P — CID 170226244
3-[[di(propan-2-yl)amino]-[5-methoxy-1-(2-methylpropanoyl)pyrrolidin-3-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 170226244) has the molecular formula C18H34N3O4P and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[5-methoxy-1-(2-methylpropanoyl)pyrrolidin-3-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[5-methoxy-1-(2-methylpropanoyl)pyrrolidin-3-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 170226244 |
| Molecular Formula | C18H34N3O4P |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[5-methoxy-1-(2-methylpropanoyl)pyrrolidin-3-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | COC1CC(OP(OCCC#N)N(C(C)C)C(C)C)CN1C(=O)C(C)C |
| InChI | InChI=1S/C18H34N3O4P/c1-13(2)18(22)20-12-16(11-17(20)23-7)25-26(24-10-8-9-19)21(14(3)4)15(5)6/h13-17H,8,10-12H2,1-7H3 |
| InChIKey | MLTOJRFUHXIINE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|