C16H30N3O3P — CID 153320620
3-[[(3R,5R)-1-acetyl-5-(deuteriomethyl)pyrrolidin-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 153320620) has the molecular formula C16H30N3O3P and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[[(3R,5R)-1-acetyl-5-(deuteriomethyl)pyrrolidin-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(3R,5R)-1-acetyl-5-(deuteriomethyl)pyrrolidin-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 153320620 |
| Molecular Formula | C16H30N3O3P |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 3-[[(3R,5R)-1-acetyl-5-(deuteriomethyl)pyrrolidin-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | [2H]C[C@@H]1C[C@@H](OP(OCCC#N)N(C(C)C)C(C)C)CN1C(C)=O |
| InChI | InChI=1S/C16H30N3O3P/c1-12(2)19(13(3)4)23(21-9-7-8-17)22-16-10-14(5)18(11-16)15(6)20/h12-14,16H,7,9-11H2,1-6H3/t14-,16-,23?/m1/s1/i5D |
| InChIKey | PSIDOPDWXCWRRH-HHKFNFGESA-N |
| XLogP | 3.29 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|