C31H58N3O3P — CID 166590703
3-[[di(propan-2-yl)amino]-[(3S)-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 166590703) has the molecular formula C31H58N3O3P and a molecular weight of 551.80 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[(3S)-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[(3S)-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 166590703 |
| Molecular Formula | C31H58N3O3P |
| Molecular Weight | 551.80 g/mol |
| Exact Mass | 551.42 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[(3S)-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N1CC[C@H](OP(OCCC#N)N(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C31H58N3O3P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-31(35)33-25-23-30(27-33)37-38(36-26-21-24-32)34(28(2)3)29(4)5/h13-14,28-30H,6-12,15-23,25-27H2,1-5H3/b14-13-/t30-,38?/m0/s1 |
| InChIKey | QMGVTUOHPZGEQE-HBOBHEJCSA-N |
| XLogP | 8.92 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.80 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|