C15H20FeN2 — CID 625058
2-(aziridin-1-yl)-N-(cyclopenta-1,3-dien-1-ylmethyl)ethanamine;cyclopenta-1,3-diene;iron(2+) (PubChem CID 625058) has the molecular formula C15H20FeN2 and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-(aziridin-1-yl)-N-(cyclopenta-1,3-dien-1-ylmethyl)ethanamine;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 2-(aziridin-1-yl)-N-(cyclopenta-1,3-dien-1-ylmethyl)ethanamine;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 625058 |
| Molecular Formula | C15H20FeN2 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(aziridin-1-yl)-N-(cyclopenta-1,3-dien-1-ylmethyl)ethanamine;cyclopenta-1,3-diene;iron(2+) |
| SMILES | [Fe+2].c1c[cH-]c(CNCCN2CC2)c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C10H15N2.C5H5.Fe/c1-2-4-10(3-1)9-11-5-6-12-7-8-12;1-2-4-5-3-1;/h1-4,11H,5-9H2;1-5H;/q2*-1;+2 |
| InChIKey | VJQQMCCFOUOHGM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|