About 2-acetylbenzohydrazide;hydrochloride
2-acetylbenzohydrazide;hydrochloride (PubChem CID 175815383) has the molecular formula C9H11ClN2O2
and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-acetylbenzohydrazide;hydrochloride.
Molecular Properties
| Compound Name | 2-acetylbenzohydrazide;hydrochloride |
| PubChem CID | 175815383 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-acetylbenzohydrazide;hydrochloride |
| SMILES | CC(=O)c1ccccc1C(=O)NN.Cl |
| InChI | InChI=1S/C9H10N2O2.ClH/c1-6(12)7-4-2-3-5-8(7)9(13)11-10;/h2-5H,10H2,1H3,(H,11,13);1H |
| InChIKey | PYMRYPVQQFZYTR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-acetylbenzohydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylbenzohydrazide;hydrochloride?
The IUPAC name of 2-acetylbenzohydrazide;hydrochloride (CID 175815383) is 2-acetylbenzohydrazide;hydrochloride.
What is the SMILES notation for 2-acetylbenzohydrazide;hydrochloride?
The canonical SMILES for 2-acetylbenzohydrazide;hydrochloride is CC(=O)c1ccccc1C(=O)NN.Cl.
What is the InChIKey of 2-acetylbenzohydrazide;hydrochloride?
The InChIKey is PYMRYPVQQFZYTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2.ClH/c1-6(12)7-4-2-3-5-8(7)9(13)11-10;/h2-5H,10H2,1H3,(H,11,13);1H.
What are the key properties of 2-acetylbenzohydrazide;hydrochloride?
2-acetylbenzohydrazide;hydrochloride has a molecular weight of 214.65 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylbenzohydrazide;hydrochloride is sourced from PubChem (CID 175815383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).